C15H8ClNO — CID 162517870
10-chloronaphtho[2,1-g][1,3]benzoxazole (PubChem CID 162517870) has the molecular formula C15H8ClNO and a molecular weight of 253.69 g/mol. Its IUPAC name is 10-chloronaphtho[2,1-g][1,3]benzoxazole.
| Compound Name | 10-chloronaphtho[2,1-g][1,3]benzoxazole |
|---|---|
| PubChem CID | 162517870 |
| Molecular Formula | C15H8ClNO |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 10-chloronaphtho[2,1-g][1,3]benzoxazole |
| SMILES | Clc1ccc2ccc3ccc4ncoc4c3c2c1 |
| InChI | InChI=1S/C15H8ClNO/c16-11-5-3-9-1-2-10-4-6-13-15(18-8-17-13)14(10)12(9)7-11/h1-8H |
| InChIKey | TWLOFTIEUFGEIA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|