C14H8N2O — CID 176655511
[1,3]oxazolo[5,4-a]acridine (PubChem CID 176655511) has the molecular formula C14H8N2O and a molecular weight of 220.23 g/mol. Its IUPAC name is [1,3]oxazolo[5,4-a]acridine.
| Compound Name | [1,3]oxazolo[5,4-a]acridine |
|---|---|
| PubChem CID | 176655511 |
| Molecular Formula | C14H8N2O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | [1,3]oxazolo[5,4-a]acridine |
| SMILES | c1ccc2nc3ccc4ncoc4c3cc2c1 |
| InChI | InChI=1S/C14H8N2O/c1-2-4-11-9(3-1)7-10-12(16-11)5-6-13-14(10)17-8-15-13/h1-8H |
| InChIKey | PIYJXQSQQKBBMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|