C9H5NO2 — CID 45120277
furo[2,3-g][1,3]benzoxazole (PubChem CID 45120277) has the molecular formula C9H5NO2 and a molecular weight of 159.14 g/mol. Its IUPAC name is furo[2,3-g][1,3]benzoxazole.
| Compound Name | furo[2,3-g][1,3]benzoxazole |
|---|---|
| PubChem CID | 45120277 |
| Molecular Formula | C9H5NO2 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | furo[2,3-g][1,3]benzoxazole |
| SMILES | c1cc2c(ccc3ncoc32)o1 |
| InChI | InChI=1S/C9H5NO2/c1-2-8-6(3-4-11-8)9-7(1)10-5-12-9/h1-5H |
| InChIKey | ZZYJNUAUZDNLRL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |