C15H10ClNO — CID 68728891
[1]benzofuro[4,5-g]quinoline;hydrochloride (PubChem CID 68728891) has the molecular formula C15H10ClNO and a molecular weight of 255.70 g/mol. Its IUPAC name is [1]benzofuro[4,5-g]quinoline;hydrochloride.
| Compound Name | [1]benzofuro[4,5-g]quinoline;hydrochloride |
|---|---|
| PubChem CID | 68728891 |
| Molecular Formula | C15H10ClNO |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | [1]benzofuro[4,5-g]quinoline;hydrochloride |
| SMILES | Cl.c1cnc2cc3ccc4occc4c3cc2c1 |
| InChI | InChI=1S/C15H9NO.ClH/c1-2-11-8-13-10(9-14(11)16-6-1)3-4-15-12(13)5-7-17-15;/h1-9H;1H |
| InChIKey | ROOJIXALJWHPJQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|