C12H8N2O2 — CID 141167289
2-methylpyrido[2,3-g][3,1]benzoxazin-4-one (PubChem CID 141167289) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-methylpyrido[2,3-g][3,1]benzoxazin-4-one.
| Compound Name | 2-methylpyrido[2,3-g][3,1]benzoxazin-4-one |
|---|---|
| PubChem CID | 141167289 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-methylpyrido[2,3-g][3,1]benzoxazin-4-one |
| SMILES | Cc1nc2cc3cccnc3cc2c(=O)o1 |
| InChI | InChI=1S/C12H8N2O2/c1-7-14-11-5-8-3-2-4-13-10(8)6-9(11)12(15)16-7/h2-6H,1H3 |
| InChIKey | AKEAGLRIMGVECW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|