About ethane;quinolin-7-ol
ethane;quinolin-7-ol (PubChem CID 143537862) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is ethane;quinolin-7-ol.
Molecular Properties
| Compound Name | ethane;quinolin-7-ol |
| PubChem CID | 143537862 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | ethane;quinolin-7-ol |
| SMILES | CC.Oc1ccc2cccnc2c1 |
| InChI | InChI=1S/C9H7NO.C2H6/c11-8-4-3-7-2-1-5-10-9(7)6-8;1-2/h1-6,11H;1-2H3 |
| InChIKey | OIPNJPCEBOQIBS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;quinolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;quinolin-7-ol?
The IUPAC name of ethane;quinolin-7-ol (CID 143537862) is ethane;quinolin-7-ol.
What is the SMILES notation for ethane;quinolin-7-ol?
The canonical SMILES for ethane;quinolin-7-ol is CC.Oc1ccc2cccnc2c1.
What is the InChIKey of ethane;quinolin-7-ol?
The InChIKey is OIPNJPCEBOQIBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C2H6/c11-8-4-3-7-2-1-5-10-9(7)6-8;1-2/h1-6,11H;1-2H3.
What are the key properties of ethane;quinolin-7-ol?
ethane;quinolin-7-ol has a molecular weight of 175.23 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;quinolin-7-ol is sourced from PubChem (CID 143537862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).