About 7-phenylmethoxyquinoline;quinolin-7-ol
7-phenylmethoxyquinoline;quinolin-7-ol (PubChem CID 160975104) has the molecular formula C25H20N2O2
and a molecular weight of 380.45 g/mol. Its IUPAC name is 7-phenylmethoxyquinoline;quinolin-7-ol.
Molecular Properties
| Compound Name | 7-phenylmethoxyquinoline;quinolin-7-ol |
| PubChem CID | 160975104 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 7-phenylmethoxyquinoline;quinolin-7-ol |
| SMILES | Oc1ccc2cccnc2c1.c1ccc(COc2ccc3cccnc3c2)cc1 |
| InChI | InChI=1S/C16H13NO.C9H7NO/c1-2-5-13(6-3-1)12-18-15-9-8-14-7-4-10-17-16(14)11-15;11-8-4-3-7-2-1-5-10-9(7)6-8/h1-11H,12H2;1-6,11H |
| InChIKey | SYTIXAWTLIVGJH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-phenylmethoxyquinoline;quinolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylmethoxyquinoline;quinolin-7-ol?
The IUPAC name of 7-phenylmethoxyquinoline;quinolin-7-ol (CID 160975104) is 7-phenylmethoxyquinoline;quinolin-7-ol.
What is the SMILES notation for 7-phenylmethoxyquinoline;quinolin-7-ol?
The canonical SMILES for 7-phenylmethoxyquinoline;quinolin-7-ol is Oc1ccc2cccnc2c1.c1ccc(COc2ccc3cccnc3c2)cc1.
What is the InChIKey of 7-phenylmethoxyquinoline;quinolin-7-ol?
The InChIKey is SYTIXAWTLIVGJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO.C9H7NO/c1-2-5-13(6-3-1)12-18-15-9-8-14-7-4-10-17-16(14)11-15;11-8-4-3-7-2-1-5-10-9(7)6-8/h1-11H,12H2;1-6,11H.
What are the key properties of 7-phenylmethoxyquinoline;quinolin-7-ol?
7-phenylmethoxyquinoline;quinolin-7-ol has a molecular weight of 380.45 g/mol, XLogP of 5.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylmethoxyquinoline;quinolin-7-ol is sourced from PubChem (CID 160975104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).