About quinolin-7-ol;sulfane
quinolin-7-ol;sulfane (PubChem CID 174825329) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is quinolin-7-ol;sulfane.
Molecular Properties
| Compound Name | quinolin-7-ol;sulfane |
| PubChem CID | 174825329 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | quinolin-7-ol;sulfane |
| SMILES | Oc1ccc2cccnc2c1.S |
| InChI | InChI=1S/C9H7NO.H2S/c11-8-4-3-7-2-1-5-10-9(7)6-8;/h1-6,11H;1H2 |
| InChIKey | IQXVEVPSNJPPTO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-7-ol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-7-ol;sulfane?
The IUPAC name of quinolin-7-ol;sulfane (CID 174825329) is quinolin-7-ol;sulfane.
What is the SMILES notation for quinolin-7-ol;sulfane?
The canonical SMILES for quinolin-7-ol;sulfane is Oc1ccc2cccnc2c1.S.
What is the InChIKey of quinolin-7-ol;sulfane?
The InChIKey is IQXVEVPSNJPPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.H2S/c11-8-4-3-7-2-1-5-10-9(7)6-8;/h1-6,11H;1H2.
What are the key properties of quinolin-7-ol;sulfane?
quinolin-7-ol;sulfane has a molecular weight of 179.24 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-7-ol;sulfane is sourced from PubChem (CID 174825329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).