About 7-deuteriooxyquinoline
7-deuteriooxyquinoline (PubChem CID 138396179) has the molecular formula C9H7NO
and a molecular weight of 146.17 g/mol. Its IUPAC name is 7-deuteriooxyquinoline.
Molecular Properties
| Compound Name | 7-deuteriooxyquinoline |
| PubChem CID | 138396179 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 7-deuteriooxyquinoline |
| SMILES | [2H]Oc1ccc2cccnc2c1 |
| InChI | InChI=1S/C9H7NO/c11-8-4-3-7-2-1-5-10-9(7)6-8/h1-6,11H/i/hD |
| InChIKey | XCRPPAPDRUBKRJ-DYCDLGHISA-N |
| XLogP | 1.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-deuteriooxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-deuteriooxyquinoline?
The IUPAC name of 7-deuteriooxyquinoline (CID 138396179) is 7-deuteriooxyquinoline.
What is the SMILES notation for 7-deuteriooxyquinoline?
The canonical SMILES for 7-deuteriooxyquinoline is [2H]Oc1ccc2cccnc2c1.
What is the InChIKey of 7-deuteriooxyquinoline?
The InChIKey is XCRPPAPDRUBKRJ-DYCDLGHISA-N. The full InChI is InChI=1S/C9H7NO/c11-8-4-3-7-2-1-5-10-9(7)6-8/h1-6,11H/i/hD.
What are the key properties of 7-deuteriooxyquinoline?
7-deuteriooxyquinoline has a molecular weight of 146.17 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-deuteriooxyquinoline is sourced from PubChem (CID 138396179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).