C22H21Br3N2O2 — CID 159602221
7-(2-bromoethoxy)quinoline;1,2-dibromoethane;quinolin-7-ol (PubChem CID 159602221) has the molecular formula C22H21Br3N2O2 and a molecular weight of 585.13 g/mol. Its IUPAC name is 7-(2-bromoethoxy)quinoline;1,2-dibromoethane;quinolin-7-ol.
| Compound Name | 7-(2-bromoethoxy)quinoline;1,2-dibromoethane;quinolin-7-ol |
|---|---|
| PubChem CID | 159602221 |
| Molecular Formula | C22H21Br3N2O2 |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 581.92 |
| IUPAC Name | 7-(2-bromoethoxy)quinoline;1,2-dibromoethane;quinolin-7-ol |
| SMILES | BrCCBr.BrCCOc1ccc2cccnc2c1.Oc1ccc2cccnc2c1 |
| InChI | InChI=1S/C11H10BrNO.C9H7NO.C2H4Br2/c12-5-7-14-10-4-3-9-2-1-6-13-11(9)8-10;11-8-4-3-7-2-1-5-10-9(7)6-8;3-1-2-4/h1-4,6,8H,5,7H2;1-6,11H;1-2H2 |
| InChIKey | MLPXJAKUYMBBNR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|