C14H5Cl3N4 — CID 101466553
2,3,8-trichloroquinoxalino[2,3-b]quinoxaline (PubChem CID 101466553) has the molecular formula C14H5Cl3N4 and a molecular weight of 335.58 g/mol. Its IUPAC name is 2,3,8-trichloroquinoxalino[2,3-b]quinoxaline.
| Compound Name | 2,3,8-trichloroquinoxalino[2,3-b]quinoxaline |
|---|---|
| PubChem CID | 101466553 |
| Molecular Formula | C14H5Cl3N4 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 2,3,8-trichloroquinoxalino[2,3-b]quinoxaline |
| SMILES | Clc1ccc2nc3nc4cc(Cl)c(Cl)cc4nc3nc2c1 |
| InChI | InChI=1S/C14H5Cl3N4/c15-6-1-2-9-10(3-6)19-14-13(18-9)20-11-4-7(16)8(17)5-12(11)21-14/h1-5H |
| InChIKey | PYHZJDHTKPYOOM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|