C10H7ClN4S — CID 14147318
7-chloro-N-methyl-[1,3]thiazolo[4,5-b]quinoxalin-2-amine (PubChem CID 14147318) has the molecular formula C10H7ClN4S and a molecular weight of 250.71 g/mol. Its IUPAC name is 7-chloro-N-methyl-[1,3]thiazolo[4,5-b]quinoxalin-2-amine.
| Compound Name | 7-chloro-N-methyl-[1,3]thiazolo[4,5-b]quinoxalin-2-amine |
|---|---|
| PubChem CID | 14147318 |
| Molecular Formula | C10H7ClN4S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 7-chloro-N-methyl-[1,3]thiazolo[4,5-b]quinoxalin-2-amine |
| SMILES | CNc1nc2nc3ccc(Cl)cc3nc2s1 |
| InChI | InChI=1S/C10H7ClN4S/c1-12-10-15-8-9(16-10)14-7-4-5(11)2-3-6(7)13-8/h2-4H,1H3,(H,12,13,15) |
| InChIKey | INMKVCIMGFQHIQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |