About 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline
3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline (PubChem CID 10543399) has the molecular formula C14H6ClN3O2S
and a molecular weight of 315.74 g/mol. Its IUPAC name is 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline.
Molecular Properties
| Compound Name | 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline |
| PubChem CID | 10543399 |
| Molecular Formula | C14H6ClN3O2S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline |
| SMILES | O=[N+]([O-])c1ccc2nc3sc4cc(Cl)ccc4c3nc2c1 |
| InChI | InChI=1S/C14H6ClN3O2S/c15-7-1-3-9-12(5-7)21-14-13(9)16-11-6-8(18(19)20)2-4-10(11)17-14/h1-6H |
| InChIKey | UYGGCHGMKBUMIW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline?
The IUPAC name of 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline (CID 10543399) is 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline.
What is the SMILES notation for 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline?
The canonical SMILES for 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline is O=[N+]([O-])c1ccc2nc3sc4cc(Cl)ccc4c3nc2c1.
What is the InChIKey of 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline?
The InChIKey is UYGGCHGMKBUMIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6ClN3O2S/c15-7-1-3-9-12(5-7)21-14-13(9)16-11-6-8(18(19)20)2-4-10(11)17-14/h1-6H.
What are the key properties of 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline?
3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline has a molecular weight of 315.74 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-9-nitro-[1]benzothiolo[2,3-b]quinoxaline is sourced from PubChem (CID 10543399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).