C13H6ClN3O5S — CID 56575862
2-(4-chloro-2-nitrophenoxy)-6-nitro-1,3-benzothiazole (PubChem CID 56575862) has the molecular formula C13H6ClN3O5S and a molecular weight of 351.73 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrophenoxy)-6-nitro-1,3-benzothiazole.
| Compound Name | 2-(4-chloro-2-nitrophenoxy)-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 56575862 |
| Molecular Formula | C13H6ClN3O5S |
| Molecular Weight | 351.73 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-(4-chloro-2-nitrophenoxy)-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(Oc3ccc(Cl)cc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C13H6ClN3O5S/c14-7-1-4-11(10(5-7)17(20)21)22-13-15-9-3-2-8(16(18)19)6-12(9)23-13/h1-6H |
| InChIKey | YUYQRKZBVJZTIV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 108.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.73 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|