C18H11N3O4S — CID 56575187
6-nitro-2-(4-pyridin-2-yloxyphenoxy)-1,3-benzothiazole (PubChem CID 56575187) has the molecular formula C18H11N3O4S and a molecular weight of 365.37 g/mol. Its IUPAC name is 6-nitro-2-(4-pyridin-2-yloxyphenoxy)-1,3-benzothiazole.
| Compound Name | 6-nitro-2-(4-pyridin-2-yloxyphenoxy)-1,3-benzothiazole |
|---|---|
| PubChem CID | 56575187 |
| Molecular Formula | C18H11N3O4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 6-nitro-2-(4-pyridin-2-yloxyphenoxy)-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(Oc3ccc(Oc4ccccn4)cc3)sc2c1 |
| InChI | InChI=1S/C18H11N3O4S/c22-21(23)12-4-9-15-16(11-12)26-18(20-15)25-14-7-5-13(6-8-14)24-17-3-1-2-10-19-17/h1-11H |
| InChIKey | URWKZOATNDKCST-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|