C15H10N2O5S — CID 11359429
benzyl (6-nitro-1,3-benzothiazol-2-yl) carbonate (PubChem CID 11359429) has the molecular formula C15H10N2O5S and a molecular weight of 330.32 g/mol. Its IUPAC name is benzyl (6-nitro-1,3-benzothiazol-2-yl) carbonate.
| Compound Name | benzyl (6-nitro-1,3-benzothiazol-2-yl) carbonate |
|---|---|
| PubChem CID | 11359429 |
| Molecular Formula | C15H10N2O5S |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | benzyl (6-nitro-1,3-benzothiazol-2-yl) carbonate |
| SMILES | O=C(OCc1ccccc1)Oc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C15H10N2O5S/c18-15(21-9-10-4-2-1-3-5-10)22-14-16-12-7-6-11(17(19)20)8-13(12)23-14/h1-8H,9H2 |
| InChIKey | LMMZHGQDIOGCMH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|