C18H12N4O5S — CID 90574228
N-(6-nitro-1,3-benzothiazol-2-yl)-3-phenylmethoxy-1,2-oxazole-5-carboxamide (PubChem CID 90574228) has the molecular formula C18H12N4O5S and a molecular weight of 396.38 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-3-phenylmethoxy-1,2-oxazole-5-carboxamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-3-phenylmethoxy-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 90574228 |
| Molecular Formula | C18H12N4O5S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-3-phenylmethoxy-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1cc(OCc2ccccc2)no1 |
| InChI | InChI=1S/C18H12N4O5S/c23-17(14-9-16(21-27-14)26-10-11-4-2-1-3-5-11)20-18-19-13-7-6-12(22(24)25)8-15(13)28-18/h1-9H,10H2,(H,19,20,23) |
| InChIKey | DCTMJBWPEXHEKG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|