C14H9N3O6S — CID 27378245
5-methoxy-N-(6-nitro-1,3-benzothiazol-2-yl)-4-oxopyran-2-carboxamide (PubChem CID 27378245) has the molecular formula C14H9N3O6S and a molecular weight of 347.31 g/mol. Its IUPAC name is 5-methoxy-N-(6-nitro-1,3-benzothiazol-2-yl)-4-oxopyran-2-carboxamide.
| Compound Name | 5-methoxy-N-(6-nitro-1,3-benzothiazol-2-yl)-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 27378245 |
| Molecular Formula | C14H9N3O6S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 5-methoxy-N-(6-nitro-1,3-benzothiazol-2-yl)-4-oxopyran-2-carboxamide |
| SMILES | COc1coc(C(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1=O |
| InChI | InChI=1S/C14H9N3O6S/c1-22-11-6-23-10(5-9(11)18)13(19)16-14-15-8-3-2-7(17(20)21)4-12(8)24-14/h2-6H,1H3,(H,15,16,19) |
| InChIKey | IYCXMJCPXILUJI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|