C21H17N3O6S — CID 21046058
5-[(2,5-dimethoxyphenyl)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 21046058) has the molecular formula C21H17N3O6S and a molecular weight of 439.45 g/mol. Its IUPAC name is 5-[(2,5-dimethoxyphenyl)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-[(2,5-dimethoxyphenyl)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21046058 |
| Molecular Formula | C21H17N3O6S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 5-[(2,5-dimethoxyphenyl)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | COc1ccc(OC)c(Cc2ccc(C(=O)Nc3nc4ccc([N+](=O)[O-])cc4s3)o2)c1 |
| InChI | InChI=1S/C21H17N3O6S/c1-28-14-4-7-17(29-2)12(9-14)10-15-5-8-18(30-15)20(25)23-21-22-16-6-3-13(24(26)27)11-19(16)31-21/h3-9,11H,10H2,1-2H3,(H,22,23,25) |
| InChIKey | GJSKKIRULAYYIZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|