C17H11N5O3S2 — CID 30860152
2-anilino-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 30860152) has the molecular formula C17H11N5O3S2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-anilino-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-anilino-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 30860152 |
| Molecular Formula | C17H11N5O3S2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 2-anilino-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1csc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C17H11N5O3S2/c23-15(13-9-26-16(20-13)18-10-4-2-1-3-5-10)21-17-19-12-7-6-11(22(24)25)8-14(12)27-17/h1-9H,(H,18,20)(H,19,21,23) |
| InChIKey | CTDBIZUVZRWDDB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|