C8H3N2NaO4S — CID 141165139
sodium 6-nitro-1,3-benzothiazole-2-carboxylate (PubChem CID 141165139) has the molecular formula C8H3N2NaO4S and a molecular weight of 246.18 g/mol. Its IUPAC name is sodium 6-nitro-1,3-benzothiazole-2-carboxylate.
| Compound Name | sodium 6-nitro-1,3-benzothiazole-2-carboxylate |
|---|---|
| PubChem CID | 141165139 |
| Molecular Formula | C8H3N2NaO4S |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | sodium 6-nitro-1,3-benzothiazole-2-carboxylate |
| SMILES | O=C([O-])c1nc2ccc([N+](=O)[O-])cc2s1.[Na+] |
| InChI | InChI=1S/C8H4N2O4S.Na/c11-8(12)7-9-5-2-1-4(10(13)14)3-6(5)15-7;/h1-3H,(H,11,12);/q;+1/p-1 |
| InChIKey | DZOWVXJQABXHNI-UHFFFAOYSA-M |
| XLogP | -2.43 |
| TPSA | 96.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|