C8H6N2O3S — CID 638562
2-methoxy-6-nitro-1,3-benzothiazole (PubChem CID 638562) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is 2-methoxy-6-nitro-1,3-benzothiazole.
| Compound Name | 2-methoxy-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 638562 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-methoxy-6-nitro-1,3-benzothiazole |
| SMILES | COc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C8H6N2O3S/c1-13-8-9-6-3-2-5(10(11)12)4-7(6)14-8/h2-4H,1H3 |
| InChIKey | DQGFFBDFHDXHCN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|