C13H17N3O4S — CID 142441569
N,N-bis(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 142441569) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N,N-bis(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 142441569 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | COCCN(CCOC)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C13H17N3O4S/c1-19-7-5-15(6-8-20-2)13-14-11-4-3-10(16(17)18)9-12(11)21-13/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | CCBSGEZYOWRYLF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|