C15H19N3O5S2 — CID 8916047
N,N-bis(2-methoxyethyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide (PubChem CID 8916047) has the molecular formula C15H19N3O5S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N,N-bis(2-methoxyethyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 8916047 |
| Molecular Formula | C15H19N3O5S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
| SMILES | COCCN(CCOC)C(=O)CSc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C15H19N3O5S2/c1-22-7-5-17(6-8-23-2)14(19)10-24-15-16-12-4-3-11(18(20)21)9-13(12)25-15/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | MGWUEDWKNHTIDJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|