C8H5NO4S — CID 130883313
6-nitro-1-benzothiophene-2,3-diol (PubChem CID 130883313) has the molecular formula C8H5NO4S and a molecular weight of 211.20 g/mol. Its IUPAC name is 6-nitro-1-benzothiophene-2,3-diol.
| Compound Name | 6-nitro-1-benzothiophene-2,3-diol |
|---|---|
| PubChem CID | 130883313 |
| Molecular Formula | C8H5NO4S |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | 6-nitro-1-benzothiophene-2,3-diol |
| SMILES | O=[N+]([O-])c1ccc2c(O)c(O)sc2c1 |
| InChI | InChI=1S/C8H5NO4S/c10-7-5-2-1-4(9(12)13)3-6(5)14-8(7)11/h1-3,10-11H |
| InChIKey | QFHJIWUCQOSAPX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|