C13H5F3N2O4S — CID 23068158
3,7-dinitro-1-(trifluoromethyl)dibenzothiophene (PubChem CID 23068158) has the molecular formula C13H5F3N2O4S and a molecular weight of 342.25 g/mol. Its IUPAC name is 3,7-dinitro-1-(trifluoromethyl)dibenzothiophene.
| Compound Name | 3,7-dinitro-1-(trifluoromethyl)dibenzothiophene |
|---|---|
| PubChem CID | 23068158 |
| Molecular Formula | C13H5F3N2O4S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 3,7-dinitro-1-(trifluoromethyl)dibenzothiophene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)sc1cc([N+](=O)[O-])cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C13H5F3N2O4S/c14-13(15,16)9-3-7(18(21)22)5-11-12(9)8-2-1-6(17(19)20)4-10(8)23-11/h1-5H |
| InChIKey | VWAXHGICHJIYEV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|