C18H8F6N2O5 — CID 10551341
2,5-bis[4-nitro-2-(trifluoromethyl)phenyl]furan (PubChem CID 10551341) has the molecular formula C18H8F6N2O5 and a molecular weight of 446.26 g/mol. Its IUPAC name is 2,5-bis[4-nitro-2-(trifluoromethyl)phenyl]furan.
| Compound Name | 2,5-bis[4-nitro-2-(trifluoromethyl)phenyl]furan |
|---|---|
| PubChem CID | 10551341 |
| Molecular Formula | C18H8F6N2O5 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 2,5-bis[4-nitro-2-(trifluoromethyl)phenyl]furan |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(-c3ccc([N+](=O)[O-])cc3C(F)(F)F)o2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H8F6N2O5/c19-17(20,21)13-7-9(25(27)28)1-3-11(13)15-5-6-16(31-15)12-4-2-10(26(29)30)8-14(12)18(22,23)24/h1-8H |
| InChIKey | JTDGPFYEZOPGEL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 99.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|