C13H10F3NO3 — CID 135262001
4-[4-nitro-2-(trifluoromethyl)phenyl]cyclohex-3-en-1-one (PubChem CID 135262001) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is 4-[4-nitro-2-(trifluoromethyl)phenyl]cyclohex-3-en-1-one.
| Compound Name | 4-[4-nitro-2-(trifluoromethyl)phenyl]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 135262001 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-[4-nitro-2-(trifluoromethyl)phenyl]cyclohex-3-en-1-one |
| SMILES | O=C1CC=C(c2ccc([N+](=O)[O-])cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H10F3NO3/c14-13(15,16)12-7-9(17(19)20)3-6-11(12)8-1-4-10(18)5-2-8/h1,3,6-7H,2,4-5H2 |
| InChIKey | FARPJMZSHREKNM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|