C21H21ClF4N2O3 — CID 86298988
1-(4-fluorophenyl)-3-[4-[4-nitro-2-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]propan-1-ol;hydrochloride (PubChem CID 86298988) has the molecular formula C21H21ClF4N2O3 and a molecular weight of 460.86 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[4-nitro-2-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]propan-1-ol;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[4-nitro-2-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 86298988 |
| Molecular Formula | C21H21ClF4N2O3 |
| Molecular Weight | 460.86 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[4-nitro-2-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]propan-1-ol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(C2=CCN(CCC(O)c3ccc(F)cc3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F4N2O3.ClH/c22-16-3-1-15(2-4-16)20(28)9-12-26-10-7-14(8-11-26)18-6-5-17(27(29)30)13-19(18)21(23,24)25;/h1-7,13,20,28H,8-12H2;1H |
| InChIKey | UARHLFPHDJCILO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.86 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|