C21H24N2O3 — CID 66572281
3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(4-nitrophenyl)propan-1-ol (PubChem CID 66572281) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(4-nitrophenyl)propan-1-ol.
| Compound Name | 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(4-nitrophenyl)propan-1-ol |
|---|---|
| PubChem CID | 66572281 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-(4-benzyl-3,6-dihydro-2H-pyridin-1-yl)-1-(4-nitrophenyl)propan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(C(O)CCN2CC=C(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c24-21(19-6-8-20(9-7-19)23(25)26)12-15-22-13-10-18(11-14-22)16-17-4-2-1-3-5-17/h1-10,21,24H,11-16H2 |
| InChIKey | CLPXEXYSIPWDMI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|