C19H25N3O3+2 — CID 6952643
(1R)-2-(4-benzylpiperazine-1,4-diium-1-yl)-1-(4-nitrophenyl)ethanol (PubChem CID 6952643) has the molecular formula C19H25N3O3+2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (1R)-2-(4-benzylpiperazine-1,4-diium-1-yl)-1-(4-nitrophenyl)ethanol.
| Compound Name | (1R)-2-(4-benzylpiperazine-1,4-diium-1-yl)-1-(4-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 6952643 |
| Molecular Formula | C19H25N3O3+2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (1R)-2-(4-benzylpiperazine-1,4-diium-1-yl)-1-(4-nitrophenyl)ethanol |
| SMILES | O=[N+]([O-])c1ccc([C@@H](O)C[NH+]2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c23-19(17-6-8-18(9-7-17)22(24)25)15-21-12-10-20(11-13-21)14-16-4-2-1-3-5-16/h1-9,19,23H,10-15H2/p+2/t19-/m0/s1 |
| InChIKey | NOOZVSMQWFDGGH-IBGZPJMESA-P |
| XLogP | -0.39 |
| TPSA | 72.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|