C22H25N3O3+2 — CID 7443803
1-benzyl-4-[[5-(4-nitrophenyl)furan-2-yl]methyl]piperazine-1,4-diium (PubChem CID 7443803) has the molecular formula C22H25N3O3+2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-benzyl-4-[[5-(4-nitrophenyl)furan-2-yl]methyl]piperazine-1,4-diium.
| Compound Name | 1-benzyl-4-[[5-(4-nitrophenyl)furan-2-yl]methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7443803 |
| Molecular Formula | C22H25N3O3+2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-benzyl-4-[[5-(4-nitrophenyl)furan-2-yl]methyl]piperazine-1,4-diium |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C[NH+]3CC[NH+](Cc4ccccc4)CC3)o2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c26-25(27)20-8-6-19(7-9-20)22-11-10-21(28-22)17-24-14-12-23(13-15-24)16-18-4-2-1-3-5-18/h1-11H,12-17H2/p+2 |
| InChIKey | GXOHZSWYTYOKPE-UHFFFAOYSA-P |
| XLogP | 1.34 |
| TPSA | 65.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|