C11H19N3O3+2 — CID 6940236
1-ethyl-4-[(5-nitrofuran-2-yl)methyl]piperazine-1,4-diium (PubChem CID 6940236) has the molecular formula C11H19N3O3+2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-ethyl-4-[(5-nitrofuran-2-yl)methyl]piperazine-1,4-diium.
| Compound Name | 1-ethyl-4-[(5-nitrofuran-2-yl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6940236 |
| Molecular Formula | C11H19N3O3+2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-ethyl-4-[(5-nitrofuran-2-yl)methyl]piperazine-1,4-diium |
| SMILES | CC[NH+]1CC[NH+](Cc2ccc([N+](=O)[O-])o2)CC1 |
| InChI | InChI=1S/C11H17N3O3/c1-2-12-5-7-13(8-6-12)9-10-3-4-11(17-10)14(15)16/h3-4H,2,5-9H2,1H3/p+2 |
| InChIKey | KDFIFYPLKBQDDT-UHFFFAOYSA-P |
| XLogP | -1.51 |
| TPSA | 65.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|