C16H17F3N3O3+ — CID 7060371
1-[(5-nitrofuran-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium (PubChem CID 7060371) has the molecular formula C16H17F3N3O3+ and a molecular weight of 356.32 g/mol. Its IUPAC name is 1-[(5-nitrofuran-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium.
| Compound Name | 1-[(5-nitrofuran-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
|---|---|
| PubChem CID | 7060371 |
| Molecular Formula | C16H17F3N3O3+ |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[(5-nitrofuran-2-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
| SMILES | O=[N+]([O-])c1ccc(C[NH+]2CCN(c3cccc(C(F)(F)F)c3)CC2)o1 |
| InChI | InChI=1S/C16H16F3N3O3/c17-16(18,19)12-2-1-3-13(10-12)21-8-6-20(7-9-21)11-14-4-5-15(25-14)22(23)24/h1-5,10H,6-9,11H2/p+1 |
| InChIKey | XKGSJZNTSDZQPH-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 63.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|