C18H19BrF3N2+ — CID 6983028
1-[(4-bromophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium (PubChem CID 6983028) has the molecular formula C18H19BrF3N2+ and a molecular weight of 400.26 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
|---|---|
| PubChem CID | 6983028 |
| Molecular Formula | C18H19BrF3N2+ |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
| SMILES | FC(F)(F)c1cccc(N2CC[NH+](Cc3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C18H18BrF3N2/c19-16-6-4-14(5-7-16)13-23-8-10-24(11-9-23)17-3-1-2-15(12-17)18(20,21)22/h1-7,12H,8-11,13H2/p+1 |
| InChIKey | MWKIJVNPSWEFCJ-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |