C22H22F3N2+ — CID 6961989
1-(naphthalen-2-ylmethyl)-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium (PubChem CID 6961989) has the molecular formula C22H22F3N2+ and a molecular weight of 371.43 g/mol. Its IUPAC name is 1-(naphthalen-2-ylmethyl)-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium.
| Compound Name | 1-(naphthalen-2-ylmethyl)-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
|---|---|
| PubChem CID | 6961989 |
| Molecular Formula | C22H22F3N2+ |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-(naphthalen-2-ylmethyl)-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
| SMILES | FC(F)(F)c1cccc(N2CC[NH+](Cc3ccc4ccccc4c3)CC2)c1 |
| InChI | InChI=1S/C22H21F3N2/c23-22(24,25)20-6-3-7-21(15-20)27-12-10-26(11-13-27)16-17-8-9-18-4-1-2-5-19(18)14-17/h1-9,14-15H,10-13,16H2/p+1 |
| InChIKey | QQQLCXVTAFVNLH-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |