C21H28F3N2+ — CID 11904585
1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium (PubChem CID 11904585) has the molecular formula C21H28F3N2+ and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium.
| Compound Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
|---|---|
| PubChem CID | 11904585 |
| Molecular Formula | C21H28F3N2+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
| SMILES | CC1(C)[C@H]2CC=C(C[NH+]3CCN(c4cccc(C(F)(F)F)c4)CC3)[C@@H]1C2 |
| InChI | InChI=1S/C21H27F3N2/c1-20(2)16-7-6-15(19(20)13-16)14-25-8-10-26(11-9-25)18-5-3-4-17(12-18)21(22,23)24/h3-6,12,16,19H,7-11,13-14H2,1-2H3/p+1/t16-,19-/m0/s1 |
| InChIKey | BJWOJNPXRMBTHI-LPHOPBHVSA-O |
| XLogP | 3.40 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|