C19H28F3N2+ — CID 7441354
1-cyclooctyl-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium (PubChem CID 7441354) has the molecular formula C19H28F3N2+ and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-cyclooctyl-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium.
| Compound Name | 1-cyclooctyl-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
|---|---|
| PubChem CID | 7441354 |
| Molecular Formula | C19H28F3N2+ |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-cyclooctyl-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium |
| SMILES | FC(F)(F)c1cccc(N2CC[NH+](C3CCCCCCC3)CC2)c1 |
| InChI | InChI=1S/C19H27F3N2/c20-19(21,22)16-7-6-10-18(15-16)24-13-11-23(12-14-24)17-8-4-2-1-3-5-9-17/h6-7,10,15,17H,1-5,8-9,11-14H2/p+1 |
| InChIKey | HKQFXGOETYYZMU-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |