C17H24F3N3 — CID 784417
1-(1-methylpiperidin-4-yl)-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 784417) has the molecular formula C17H24F3N3 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-(1-methylpiperidin-4-yl)-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 784417 |
| Molecular Formula | C17H24F3N3 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | CN1CCC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C17H24F3N3/c1-21-7-5-15(6-8-21)22-9-11-23(12-10-22)16-4-2-3-14(13-16)17(18,19)20/h2-4,13,15H,5-12H2,1H3 |
| InChIKey | UVLWLYGPCRPEJB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |