C16H22F3N3 — CID 93115751
1-[(3R)-piperidin-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 93115751) has the molecular formula C16H22F3N3 and a molecular weight of 313.37 g/mol. Its IUPAC name is 1-[(3R)-piperidin-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(3R)-piperidin-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 93115751 |
| Molecular Formula | C16H22F3N3 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[(3R)-piperidin-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN([C@@H]3CCCNC3)CC2)c1 |
| InChI | InChI=1S/C16H22F3N3/c17-16(18,19)13-3-1-4-14(11-13)21-7-9-22(10-8-21)15-5-2-6-20-12-15/h1,3-4,11,15,20H,2,5-10,12H2/t15-/m1/s1 |
| InChIKey | VCEBVQUNVRUVPC-OAHLLOKOSA-N |
| XLogP | 2.58 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |