C20H26F3N3O — CID 42516872
cyclopropyl-[(3R)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone (PubChem CID 42516872) has the molecular formula C20H26F3N3O and a molecular weight of 381.44 g/mol. Its IUPAC name is cyclopropyl-[(3R)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[(3R)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42516872 |
| Molecular Formula | C20H26F3N3O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | cyclopropyl-[(3R)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC[C@@H](N2CCN(c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C20H26F3N3O/c21-20(22,23)16-3-1-4-17(13-16)24-9-11-25(12-10-24)18-5-2-8-26(14-18)19(27)15-6-7-15/h1,3-4,13,15,18H,2,5-12,14H2/t18-/m1/s1 |
| InChIKey | WEGQSZARWOTCBH-GOSISDBHSA-N |
| XLogP | 3.23 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |