C18H24F3N3O2 — CID 56903793
2-hydroxy-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]ethanone (PubChem CID 56903793) has the molecular formula C18H24F3N3O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-hydroxy-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-hydroxy-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 56903793 |
| Molecular Formula | C18H24F3N3O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-hydroxy-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(CO)N1CCCC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C18H24F3N3O2/c19-18(20,21)14-3-1-4-15(11-14)22-7-9-23(10-8-22)16-5-2-6-24(12-16)17(26)13-25/h1,3-4,11,16,25H,2,5-10,12-13H2 |
| InChIKey | YCORPCVMZGAYEP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |