C21H25F3N4O — CID 56919054
1H-pyrrol-2-yl-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone (PubChem CID 56919054) has the molecular formula C21H25F3N4O and a molecular weight of 406.45 g/mol. Its IUPAC name is 1H-pyrrol-2-yl-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone.
| Compound Name | 1H-pyrrol-2-yl-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56919054 |
| Molecular Formula | C21H25F3N4O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1H-pyrrol-2-yl-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc[nH]1)N1CCCC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C21H25F3N4O/c22-21(23,24)16-4-1-5-17(14-16)26-10-12-27(13-11-26)18-6-3-9-28(15-18)20(29)19-7-2-8-25-19/h1-2,4-5,7-8,14,18,25H,3,6,9-13,15H2 |
| InChIKey | IQPAZJTZORTLAO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |