C22H32F3N3 — CID 56718695
1-(1-cyclohexylpiperidin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 56718695) has the molecular formula C22H32F3N3 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-(1-cyclohexylpiperidin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-(1-cyclohexylpiperidin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 56718695 |
| Molecular Formula | C22H32F3N3 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 1-(1-cyclohexylpiperidin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN(C3CCCN(C4CCCCC4)C3)CC2)c1 |
| InChI | InChI=1S/C22H32F3N3/c23-22(24,25)18-6-4-9-20(16-18)26-12-14-27(15-13-26)21-10-5-11-28(17-21)19-7-2-1-3-8-19/h4,6,9,16,19,21H,1-3,5,7-8,10-15,17H2 |
| InChIKey | JLJJWPVFKRCCSM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |