C24H37F3N4 — CID 45213688
1-[1-(1-propylpiperidin-4-yl)piperidin-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 45213688) has the molecular formula C24H37F3N4 and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-[1-(1-propylpiperidin-4-yl)piperidin-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[1-(1-propylpiperidin-4-yl)piperidin-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 45213688 |
| Molecular Formula | C24H37F3N4 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 1-[1-(1-propylpiperidin-4-yl)piperidin-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | CCCN1CCC(N2CCCC(N3CCN(c4cccc(C(F)(F)F)c4)CC3)C2)CC1 |
| InChI | InChI=1S/C24H37F3N4/c1-2-10-28-12-8-21(9-13-28)31-11-4-7-23(19-31)30-16-14-29(15-17-30)22-6-3-5-20(18-22)24(25,26)27/h3,5-6,18,21,23H,2,4,7-17,19H2,1H3 |
| InChIKey | FAMIDDLPGCYQGT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |