C16H22F3N3 — CID 154771446
1-methyl-4-[1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperazine (PubChem CID 154771446) has the molecular formula C16H22F3N3 and a molecular weight of 313.37 g/mol. Its IUPAC name is 1-methyl-4-[1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-methyl-4-[1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 154771446 |
| Molecular Formula | C16H22F3N3 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-methyl-4-[1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]piperazine |
| SMILES | CN1CCN(C2CCN(c3cccc(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C16H22F3N3/c1-20-7-9-21(10-8-20)15-5-6-22(12-15)14-4-2-3-13(11-14)16(17,18)19/h2-4,11,15H,5-10,12H2,1H3 |
| InChIKey | AIHZBJRRCUDGIU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |