C12H14F3N — CID 123229345
3-methyl-1-[3-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 123229345) has the molecular formula C12H14F3N and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-methyl-1-[3-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | 3-methyl-1-[3-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 123229345 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-methyl-1-[3-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | CC1CCN(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H14F3N/c1-9-5-6-16(8-9)11-4-2-3-10(7-11)12(13,14)15/h2-4,7,9H,5-6,8H2,1H3 |
| InChIKey | ABLFXKPHFOKYAO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |