C16H23F3N2 — CID 146522074
4,4,6-trimethyl-1-[3-(trifluoromethyl)phenyl]-1,5-diazocane (PubChem CID 146522074) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 4,4,6-trimethyl-1-[3-(trifluoromethyl)phenyl]-1,5-diazocane.
| Compound Name | 4,4,6-trimethyl-1-[3-(trifluoromethyl)phenyl]-1,5-diazocane |
|---|---|
| PubChem CID | 146522074 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4,4,6-trimethyl-1-[3-(trifluoromethyl)phenyl]-1,5-diazocane |
| SMILES | CC1CCN(c2cccc(C(F)(F)F)c2)CCC(C)(C)N1 |
| InChI | InChI=1S/C16H23F3N2/c1-12-7-9-21(10-8-15(2,3)20-12)14-6-4-5-13(11-14)16(17,18)19/h4-6,11-12,20H,7-10H2,1-3H3 |
| InChIKey | KKNVDJXGLKMIRQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |