C14H18F3N — CID 130392683
3-ethyl-1-[3-(trifluoromethyl)phenyl]piperidine (PubChem CID 130392683) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is 3-ethyl-1-[3-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 3-ethyl-1-[3-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 130392683 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-ethyl-1-[3-(trifluoromethyl)phenyl]piperidine |
| SMILES | CCC1CCCN(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H18F3N/c1-2-11-5-4-8-18(10-11)13-7-3-6-12(9-13)14(15,16)17/h3,6-7,9,11H,2,4-5,8,10H2,1H3 |
| InChIKey | KYYYSVCSGQZBNF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |