C18H26F3N3 — CID 45217580
1-(1-ethylpiperidin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 45217580) has the molecular formula C18H26F3N3 and a molecular weight of 341.42 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 45217580 |
| Molecular Formula | C18H26F3N3 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | CCN1CCCC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C18H26F3N3/c1-2-22-8-4-7-17(14-22)24-11-9-23(10-12-24)16-6-3-5-15(13-16)18(19,20)21/h3,5-6,13,17H,2,4,7-12,14H2,1H3 |
| InChIKey | QYBLDNOQHXMDSP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |